C19H25ClN4O4 — CID 55563969
2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 55563969) has the molecular formula C19H25ClN4O4 and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 55563969 |
| Molecular Formula | C19H25ClN4O4 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCCN1C(=O)CN1CCN(C(=O)c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C19H25ClN4O4/c1-14-4-2-3-7-23(14)18(25)13-21-8-10-22(11-9-21)19(26)16-6-5-15(24(27)28)12-17(16)20/h5-6,12,14H,2-4,7-11,13H2,1H3 |
| InChIKey | XUUNTRSXCIVKOQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|