C13H15N3O5 — CID 4182062
(2,4-dinitrophenyl)-(2-methylpiperidin-1-yl)methanone (PubChem CID 4182062) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-(2-methylpiperidin-1-yl)methanone.
| Compound Name | (2,4-dinitrophenyl)-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 4182062 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2,4-dinitrophenyl)-(2-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCCN1C(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O5/c1-9-4-2-3-7-14(9)13(17)11-6-5-10(15(18)19)8-12(11)16(20)21/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | OOPULSIZXPEBSM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|