C22H31N5O5 — CID 55564684
N-[1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 55564684) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55564684 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | N-[1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CCN(CC(=O)N2CCCCC2C)CC1 |
| InChI | InChI=1S/C22H31N5O5/c1-16-6-3-4-9-26(16)20(28)15-24-10-12-25(13-11-24)22(30)17(2)23-21(29)18-7-5-8-19(14-18)27(31)32/h5,7-8,14,16-17H,3-4,6,9-13,15H2,1-2H3,(H,23,29) |
| InChIKey | KRIZTFSNSWLGRC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|