C21H23N3O5 — CID 78779296
N-[1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 78779296) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 78779296 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | COc1ccc(C2CCCN2C(=O)C(C)NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-14(22-20(25)16-5-3-6-17(13-16)24(27)28)21(26)23-12-4-7-19(23)15-8-10-18(29-2)11-9-15/h3,5-6,8-11,13-14,19H,4,7,12H2,1-2H3,(H,22,25) |
| InChIKey | AKVJEDUAOOHEON-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|