C15H21ClN4O4 — CID 119373398
N-[1-(4-aminopiperidin-1-yl)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 119373398) has the molecular formula C15H21ClN4O4 and a molecular weight of 356.81 g/mol. Its IUPAC name is N-[1-(4-aminopiperidin-1-yl)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[1-(4-aminopiperidin-1-yl)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119373398 |
| Molecular Formula | C15H21ClN4O4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[1-(4-aminopiperidin-1-yl)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CCC(N)CC1.Cl |
| InChI | InChI=1S/C15H20N4O4.ClH/c1-10(15(21)18-7-5-12(16)6-8-18)17-14(20)11-3-2-4-13(9-11)19(22)23;/h2-4,9-10,12H,5-8,16H2,1H3,(H,17,20);1H |
| InChIKey | OLCUXTATMNRBOI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|