C22H30N4O4 — CID 11090985
1-N,3-N-bis[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzene-1,3-dicarboxamide (PubChem CID 11090985) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-N,3-N-bis[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 11090985 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-N,3-N-bis[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzene-1,3-dicarboxamide |
| SMILES | C[C@H](NC(=O)c1cccc(C(=O)N[C@@H](C)C(=O)N2CCCC2)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H30N4O4/c1-15(21(29)25-10-3-4-11-25)23-19(27)17-8-7-9-18(14-17)20(28)24-16(2)22(30)26-12-5-6-13-26/h7-9,14-16H,3-6,10-13H2,1-2H3,(H,23,27)(H,24,28)/t15-,16-/m0/s1 |
| InChIKey | QIESTGBTFXFNEW-HOTGVXAUSA-N |
| XLogP | 1.17 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |