C15H18ClIN2O2 — CID 103735178
3-chloro-4-iodo-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)benzamide (PubChem CID 103735178) has the molecular formula C15H18ClIN2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is 3-chloro-4-iodo-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)benzamide.
| Compound Name | 3-chloro-4-iodo-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 103735178 |
| Molecular Formula | C15H18ClIN2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 3-chloro-4-iodo-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)benzamide |
| SMILES | CC(NC(=O)c1ccc(I)c(Cl)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H18ClIN2O2/c1-10(15(21)19-7-3-2-4-8-19)18-14(20)11-5-6-13(17)12(16)9-11/h5-6,9-10H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | ZPYVBTYWUIYNET-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|