C14H18N2O4 — CID 104938945
3,5-dihydroxy-N-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)benzamide (PubChem CID 104938945) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 104938945 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3,5-dihydroxy-N-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)benzamide |
| SMILES | CC(NC(=O)c1cc(O)cc(O)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H18N2O4/c1-9(14(20)16-4-2-3-5-16)15-13(19)10-6-11(17)8-12(18)7-10/h6-9,17-18H,2-5H2,1H3,(H,15,19) |
| InChIKey | ZIKUDGGKUUHDMD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |