C23H26ClN3O4 — CID 24758633
N-[(2R)-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 24758633) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is N-[(2R)-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[(2R)-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24758633 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[(2R)-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H26ClN3O4/c1-15(2)21(25-22(28)18-4-3-5-20(14-18)27(30)31)23(29)26-12-10-17(11-13-26)16-6-8-19(24)9-7-16/h3-9,14-15,17,21H,10-13H2,1-2H3,(H,25,28)/t21-/m1/s1 |
| InChIKey | DVXXHHBCRXMOCF-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|