C30H34ClN5O2 — CID 143524766
3-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 143524766) has the molecular formula C30H34ClN5O2 and a molecular weight of 532.09 g/mol. Its IUPAC name is 3-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 3-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 143524766 |
| Molecular Formula | C30H34ClN5O2 |
| Molecular Weight | 532.09 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 3-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]-N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1cccc(-c2ccc(/C(N)=N/N)cc2)c1)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H34ClN5O2/c1-19(2)27(30(38)36-16-14-22(15-17-36)20-10-12-26(31)13-11-20)34-29(37)25-5-3-4-24(18-25)21-6-8-23(9-7-21)28(32)35-33/h3-13,18-19,22,27H,14-17,33H2,1-2H3,(H2,32,35)(H,34,37) |
| InChIKey | SSTCNYNHOMMTTF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.09 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|