C25H35N6O2+ — CID 163915038
[amino-[3-[[3-methyl-1-[4-(4-methylphenyl)piperidin-1-yl]-1-oxobutan-2-yl]carbamoyl]phenyl]methylidene]-hydrazinylazanium (PubChem CID 163915038) has the molecular formula C25H35N6O2+ and a molecular weight of 451.60 g/mol. Its IUPAC name is [amino-[3-[[3-methyl-1-[4-(4-methylphenyl)piperidin-1-yl]-1-oxobutan-2-yl]carbamoyl]phenyl]methylidene]-hydrazinylazanium.
| Compound Name | [amino-[3-[[3-methyl-1-[4-(4-methylphenyl)piperidin-1-yl]-1-oxobutan-2-yl]carbamoyl]phenyl]methylidene]-hydrazinylazanium |
|---|---|
| PubChem CID | 163915038 |
| Molecular Formula | C25H35N6O2+ |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | [amino-[3-[[3-methyl-1-[4-(4-methylphenyl)piperidin-1-yl]-1-oxobutan-2-yl]carbamoyl]phenyl]methylidene]-hydrazinylazanium |
| SMILES | Cc1ccc(C2CCN(C(=O)C(NC(=O)c3cccc(C(N)=[NH+]NN)c3)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H34N6O2/c1-16(2)22(28-24(32)21-6-4-5-20(15-21)23(26)29-30-27)25(33)31-13-11-19(12-14-31)18-9-7-17(3)8-10-18/h4-10,15-16,19,22,30H,11-14,27H2,1-3H3,(H2,26,29)(H,28,32)/p+1 |
| InChIKey | QVMFUAJSDYKTCK-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|