C23H33ClN2O2 — CID 24759417
N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide (PubChem CID 24759417) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 24759417 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCCC1)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H33ClN2O2/c1-16(2)21(25-22(27)19-6-4-3-5-7-19)23(28)26-14-12-18(13-15-26)17-8-10-20(24)11-9-17/h8-11,16,18-19,21H,3-7,12-15H2,1-2H3,(H,25,27) |
| InChIKey | PFPBYTMHBRFCIG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |