C18H31N3O3 — CID 29439895
1-[(2S)-2-(cyclohexanecarbonylamino)-3-methylbutanoyl]piperidine-4-carboxamide (PubChem CID 29439895) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[(2S)-2-(cyclohexanecarbonylamino)-3-methylbutanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2S)-2-(cyclohexanecarbonylamino)-3-methylbutanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 29439895 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1-[(2S)-2-(cyclohexanecarbonylamino)-3-methylbutanoyl]piperidine-4-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)C1CCCCC1)C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H31N3O3/c1-12(2)15(20-17(23)14-6-4-3-5-7-14)18(24)21-10-8-13(9-11-21)16(19)22/h12-15H,3-11H2,1-2H3,(H2,19,22)(H,20,23)/t15-/m0/s1 |
| InChIKey | HLAOKYNGLCKMNV-HNNXBMFYSA-N |
| XLogP | 1.43 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |