C19H34N2O3 — CID 99824148
1-[(2R)-2-cyclohexyl-2-hydroxyacetyl]-N-[(2R)-3-methylbutan-2-yl]piperidine-4-carboxamide (PubChem CID 99824148) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1-[(2R)-2-cyclohexyl-2-hydroxyacetyl]-N-[(2R)-3-methylbutan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-cyclohexyl-2-hydroxyacetyl]-N-[(2R)-3-methylbutan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99824148 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-[(2R)-2-cyclohexyl-2-hydroxyacetyl]-N-[(2R)-3-methylbutan-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)[C@@H](C)NC(=O)C1CCN(C(=O)[C@H](O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H34N2O3/c1-13(2)14(3)20-18(23)16-9-11-21(12-10-16)19(24)17(22)15-7-5-4-6-8-15/h13-17,22H,4-12H2,1-3H3,(H,20,23)/t14-,17-/m1/s1 |
| InChIKey | DPXHURFFLTVJLS-RHSMWYFYSA-N |
| XLogP | 2.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |