C13H27N3O3S — CID 131955942
1-(dimethylsulfamoyl)-N-(3-methylbutan-2-yl)piperidine-4-carboxamide (PubChem CID 131955942) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-(3-methylbutan-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-(3-methylbutan-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 131955942 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-(3-methylbutan-2-yl)piperidine-4-carboxamide |
| SMILES | CC(C)C(C)NC(=O)C1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O3S/c1-10(2)11(3)14-13(17)12-6-8-16(9-7-12)20(18,19)15(4)5/h10-12H,6-9H2,1-5H3,(H,14,17) |
| InChIKey | PJVDRUBOKZTLQT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |