C14H29N3O3S — CID 4136250
N-butan-2-yl-1-(diethylsulfamoyl)piperidine-4-carboxamide (PubChem CID 4136250) has the molecular formula C14H29N3O3S and a molecular weight of 319.47 g/mol. Its IUPAC name is N-butan-2-yl-1-(diethylsulfamoyl)piperidine-4-carboxamide.
| Compound Name | N-butan-2-yl-1-(diethylsulfamoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4136250 |
| Molecular Formula | C14H29N3O3S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-butan-2-yl-1-(diethylsulfamoyl)piperidine-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1CCN(S(=O)(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C14H29N3O3S/c1-5-12(4)15-14(18)13-8-10-17(11-9-13)21(19,20)16(6-2)7-3/h12-13H,5-11H2,1-4H3,(H,15,18) |
| InChIKey | LXILGLXZHIECNK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |