C12H24N2O3S — CID 7255930
1-methylsulfonyl-N-[(2S)-pentan-2-yl]piperidine-4-carboxamide (PubChem CID 7255930) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[(2S)-pentan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[(2S)-pentan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7255930 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-methylsulfonyl-N-[(2S)-pentan-2-yl]piperidine-4-carboxamide |
| SMILES | CCC[C@H](C)NC(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H24N2O3S/c1-4-5-10(2)13-12(15)11-6-8-14(9-7-11)18(3,16)17/h10-11H,4-9H2,1-3H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | IDVYSKRTXTZNGQ-JTQLQIEISA-N |
| XLogP | 0.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |