C13H27N3O3S — CID 28958223
(3R)-1-(dimethylsulfamoyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide (PubChem CID 28958223) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is (3R)-1-(dimethylsulfamoyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(dimethylsulfamoyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28958223 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3R)-1-(dimethylsulfamoyl)-N-[(2S)-pentan-2-yl]piperidine-3-carboxamide |
| SMILES | CCC[C@H](C)NC(=O)[C@@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C13H27N3O3S/c1-5-7-11(2)14-13(17)12-8-6-9-16(10-12)20(18,19)15(3)4/h11-12H,5-10H2,1-4H3,(H,14,17)/t11-,12+/m0/s1 |
| InChIKey | NYEQSCCIXFGRQG-NWDGAFQWSA-N |
| XLogP | 0.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |