C19H31N3O3S — CID 30379738
(3R)-1-(dimethylsulfamoyl)-N-[(1S)-3-methyl-1-phenylbutyl]piperidine-3-carboxamide (PubChem CID 30379738) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is (3R)-1-(dimethylsulfamoyl)-N-[(1S)-3-methyl-1-phenylbutyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(dimethylsulfamoyl)-N-[(1S)-3-methyl-1-phenylbutyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30379738 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (3R)-1-(dimethylsulfamoyl)-N-[(1S)-3-methyl-1-phenylbutyl]piperidine-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN(S(=O)(=O)N(C)C)C1)c1ccccc1 |
| InChI | InChI=1S/C19H31N3O3S/c1-15(2)13-18(16-9-6-5-7-10-16)20-19(23)17-11-8-12-22(14-17)26(24,25)21(3)4/h5-7,9-10,15,17-18H,8,11-14H2,1-4H3,(H,20,23)/t17-,18+/m1/s1 |
| InChIKey | LADBVDZXIIWIQJ-MSOLQXFVSA-N |
| XLogP | 2.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |