C21H28N2O3S2 — CID 94012606
(3S)-N-[(1S)-3-methyl-1-phenylbutyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 94012606) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (3S)-N-[(1S)-3-methyl-1-phenylbutyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(1S)-3-methyl-1-phenylbutyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94012606 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (3S)-N-[(1S)-3-methyl-1-phenylbutyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H]1CCCN(S(=O)(=O)c2cccs2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-16(2)14-19(17-8-4-3-5-9-17)22-21(24)18-10-6-12-23(15-18)28(25,26)20-11-7-13-27-20/h3-5,7-9,11,13,16,18-19H,6,10,12,14-15H2,1-2H3,(H,22,24)/t18-,19-/m0/s1 |
| InChIKey | YVYVFTYVFLYWHI-OALUTQOASA-N |
| XLogP | 4.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |