C17H21N3O3S2 — CID 18160601
N-(1-pyridin-4-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 18160601) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(1-pyridin-4-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(1-pyridin-4-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 18160601 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(1-pyridin-4-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCCN(S(=O)(=O)c2cccs2)C1)c1ccncc1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-13(14-6-8-18-9-7-14)19-17(21)15-4-2-10-20(12-15)25(22,23)16-5-3-11-24-16/h3,5-9,11,13,15H,2,4,10,12H2,1H3,(H,19,21) |
| InChIKey | BMHILKUUGGMETG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |