C13H15N3O3S3 — CID 16826163
N-(1,3-thiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 16826163) has the molecular formula C13H15N3O3S3 and a molecular weight of 357.48 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16826163 |
| Molecular Formula | C13H15N3O3S3 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C13H15N3O3S3/c17-12(15-13-14-5-8-21-13)10-3-1-6-16(9-10)22(18,19)11-4-2-7-20-11/h2,4-5,7-8,10H,1,3,6,9H2,(H,14,15,17) |
| InChIKey | ZEJIRIINQSRTIQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |