C19H19N3O3S2 — CID 9325562
(3R)-N-quinolin-8-yl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 9325562) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3R)-N-quinolin-8-yl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-quinolin-8-yl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 9325562 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (3R)-N-quinolin-8-yl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C19H19N3O3S2/c23-19(21-16-8-1-5-14-6-2-10-20-18(14)16)15-7-3-11-22(13-15)27(24,25)17-9-4-12-26-17/h1-2,4-6,8-10,12,15H,3,7,11,13H2,(H,21,23)/t15-/m1/s1 |
| InChIKey | VJVUUGKTUYBAJI-OAHLLOKOSA-N |
| XLogP | 3.34 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |