C23H24N2O3S2 — CID 43013553
N-(2-benzylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 43013553) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-(2-benzylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-benzylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43013553 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-(2-benzylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cc1ccccc1)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C23H24N2O3S2/c26-23(20-11-6-14-25(17-20)30(27,28)22-13-7-15-29-22)24-21-12-5-4-10-19(21)16-18-8-2-1-3-9-18/h1-5,7-10,12-13,15,20H,6,11,14,16-17H2,(H,24,26) |
| InChIKey | MAERRRMGCAZLFA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |