C16H16Cl2N2O3S2 — CID 55412213
N-(2,4-dichlorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55412213) has the molecular formula C16H16Cl2N2O3S2 and a molecular weight of 419.36 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55412213 |
| Molecular Formula | C16H16Cl2N2O3S2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H16Cl2N2O3S2/c17-12-5-6-14(13(18)9-12)19-16(21)11-3-1-7-20(10-11)25(22,23)15-4-2-8-24-15/h2,4-6,8-9,11H,1,3,7,10H2,(H,19,21) |
| InChIKey | MWFXHQKQYMXDHL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |