C16H16F2N2O3S2 — CID 7012522
(3S)-N-(3,4-difluorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 7012522) has the molecular formula C16H16F2N2O3S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is (3S)-N-(3,4-difluorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3,4-difluorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 7012522 |
| Molecular Formula | C16H16F2N2O3S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (3S)-N-(3,4-difluorophenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)[C@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H16F2N2O3S2/c17-13-6-5-12(9-14(13)18)19-16(21)11-3-1-7-20(10-11)25(22,23)15-4-2-8-24-15/h2,4-6,8-9,11H,1,3,7,10H2,(H,19,21)/t11-/m0/s1 |
| InChIKey | GSZPFSVQZKSOHT-NSHDSACASA-N |
| XLogP | 3.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |