C16H18FN3O5S3 — CID 55980690
N-(3-fluoro-5-sulfamoylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55980690) has the molecular formula C16H18FN3O5S3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(3-fluoro-5-sulfamoylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(3-fluoro-5-sulfamoylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55980690 |
| Molecular Formula | C16H18FN3O5S3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | N-(3-fluoro-5-sulfamoylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(NC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C16H18FN3O5S3/c17-12-7-13(9-14(8-12)27(18,22)23)19-16(21)11-3-1-5-20(10-11)28(24,25)15-4-2-6-26-15/h2,4,6-9,11H,1,3,5,10H2,(H,19,21)(H2,18,22,23) |
| InChIKey | CVAIOYYOWIQSDC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |