C19H24N2O6S2 — CID 55412270
1-thiophen-2-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide (PubChem CID 55412270) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide.
| Compound Name | 1-thiophen-2-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55412270 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-thiophen-2-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H24N2O6S2/c1-25-15-10-14(11-16(26-2)18(15)27-3)20-19(22)13-6-4-8-21(12-13)29(23,24)17-7-5-9-28-17/h5,7,9-11,13H,4,6,8,12H2,1-3H3,(H,20,22) |
| InChIKey | ZHAIQZWPMFJWCH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |