C23H22N2O5S2 — CID 43013525
N-(2-methoxydibenzofuran-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 43013525) has the molecular formula C23H22N2O5S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43013525 |
| Molecular Formula | C23H22N2O5S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)C1CCCN(S(=O)(=O)c3cccs3)C1)oc1ccccc12 |
| InChI | InChI=1S/C23H22N2O5S2/c1-29-21-12-17-16-7-2-3-8-19(16)30-20(17)13-18(21)24-23(26)15-6-4-10-25(14-15)32(27,28)22-9-5-11-31-22/h2-3,5,7-9,11-13,15H,4,6,10,14H2,1H3,(H,24,26) |
| InChIKey | FKPPMJUBOUYHAN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |