C26H23ClN2O4 — CID 2111778
(3S)-1-(4-chlorobenzoyl)-N-(2-methoxydibenzofuran-3-yl)piperidine-3-carboxamide (PubChem CID 2111778) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-N-(2-methoxydibenzofuran-3-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-N-(2-methoxydibenzofuran-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2111778 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-N-(2-methoxydibenzofuran-3-yl)piperidine-3-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@H]1CCCN(C(=O)c3ccc(Cl)cc3)C1)oc1ccccc12 |
| InChI | InChI=1S/C26H23ClN2O4/c1-32-24-13-20-19-6-2-3-7-22(19)33-23(20)14-21(24)28-25(30)17-5-4-12-29(15-17)26(31)16-8-10-18(27)11-9-16/h2-3,6-11,13-14,17H,4-5,12,15H2,1H3,(H,28,30)/t17-/m0/s1 |
| InChIKey | SHWMDSBSMZFUSP-KRWDZBQOSA-N |
| XLogP | 5.74 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |