C26H25ClN2O2 — CID 2161170
(3R)-N-(2-benzylphenyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide (PubChem CID 2161170) has the molecular formula C26H25ClN2O2 and a molecular weight of 432.95 g/mol. Its IUPAC name is (3R)-N-(2-benzylphenyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(2-benzylphenyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2161170 |
| Molecular Formula | C26H25ClN2O2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (3R)-N-(2-benzylphenyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cc1ccccc1)[C@@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H25ClN2O2/c27-23-14-12-20(13-15-23)26(31)29-16-6-10-22(18-29)25(30)28-24-11-5-4-9-21(24)17-19-7-2-1-3-8-19/h1-5,7-9,11-15,22H,6,10,16-18H2,(H,28,30)/t22-/m1/s1 |
| InChIKey | NUVAKAHUAKSROJ-JOCHJYFZSA-N |
| XLogP | 5.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |