C26H25ClN2O2 — CID 3410633
N-benzhydryl-1-(4-chlorobenzoyl)piperidine-3-carboxamide (PubChem CID 3410633) has the molecular formula C26H25ClN2O2 and a molecular weight of 432.95 g/mol. Its IUPAC name is N-benzhydryl-1-(4-chlorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-benzhydryl-1-(4-chlorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3410633 |
| Molecular Formula | C26H25ClN2O2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-benzhydryl-1-(4-chlorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H25ClN2O2/c27-23-15-13-21(14-16-23)26(31)29-17-7-12-22(18-29)25(30)28-24(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,13-16,22,24H,7,12,17-18H2,(H,28,30) |
| InChIKey | MAPWYVCDDIKJPQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |