C26H23Cl2N3O3 — CID 46439094
1-(4-chlorobenzoyl)-N-[2-[(4-chlorobenzoyl)amino]phenyl]piperidine-3-carboxamide (PubChem CID 46439094) has the molecular formula C26H23Cl2N3O3 and a molecular weight of 496.39 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[2-[(4-chlorobenzoyl)amino]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[2-[(4-chlorobenzoyl)amino]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46439094 |
| Molecular Formula | C26H23Cl2N3O3 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[2-[(4-chlorobenzoyl)amino]phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1NC(=O)C1CCCN(C(=O)c2ccc(Cl)cc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O3/c27-20-11-7-17(8-12-20)24(32)29-22-5-1-2-6-23(22)30-25(33)19-4-3-15-31(16-19)26(34)18-9-13-21(28)14-10-18/h1-2,5-14,19H,3-4,15-16H2,(H,29,32)(H,30,33) |
| InChIKey | USKKSYZIFBDPPB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |