C23H25Cl2N3O3 — CID 41136127
(3S)-1-(4-chlorobenzoyl)-N-(5-chloro-2-morpholin-4-ylphenyl)piperidine-3-carboxamide (PubChem CID 41136127) has the molecular formula C23H25Cl2N3O3 and a molecular weight of 462.38 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-N-(5-chloro-2-morpholin-4-ylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-N-(5-chloro-2-morpholin-4-ylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 41136127 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-N-(5-chloro-2-morpholin-4-ylphenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCOCC1)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H25Cl2N3O3/c24-18-5-3-16(4-6-18)23(30)28-9-1-2-17(15-28)22(29)26-20-14-19(25)7-8-21(20)27-10-12-31-13-11-27/h3-8,14,17H,1-2,9-13,15H2,(H,26,29)/t17-/m0/s1 |
| InChIKey | MCLLQVIEZSXAFR-KRWDZBQOSA-N |
| XLogP | 4.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |