C25H23ClN2O2 — CID 2542955
(3S)-1-(4-chlorobenzoyl)-N-(4-phenylphenyl)piperidine-3-carboxamide (PubChem CID 2542955) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-N-(4-phenylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-N-(4-phenylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2542955 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-N-(4-phenylphenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H23ClN2O2/c26-22-12-8-20(9-13-22)25(30)28-16-4-7-21(17-28)24(29)27-23-14-10-19(11-15-23)18-5-2-1-3-6-18/h1-3,5-6,8-15,21H,4,7,16-17H2,(H,27,29)/t21-/m0/s1 |
| InChIKey | DYYJXHBRLYUTJO-NRFANRHFSA-N |
| XLogP | 5.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |