C20H21ClN2O4S — CID 25162245
1-(4-chlorobenzoyl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide (PubChem CID 25162245) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 25162245 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-(4-methylsulfonylphenyl)piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)C2CCCN(C(=O)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-28(26,27)18-10-8-17(9-11-18)22-19(24)15-3-2-12-23(13-15)20(25)14-4-6-16(21)7-5-14/h4-11,15H,2-3,12-13H2,1H3,(H,22,24) |
| InChIKey | DHMZQVADSDTNTK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |