C24H28ClN3O2S — CID 95154867
(3S)-1-(4-chlorobenzoyl)-N-[4-(thiomorpholin-4-ylmethyl)phenyl]piperidine-3-carboxamide (PubChem CID 95154867) has the molecular formula C24H28ClN3O2S and a molecular weight of 458.03 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-N-[4-(thiomorpholin-4-ylmethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-N-[4-(thiomorpholin-4-ylmethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95154867 |
| Molecular Formula | C24H28ClN3O2S |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-N-[4-(thiomorpholin-4-ylmethyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(CN2CCSCC2)cc1)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H28ClN3O2S/c25-21-7-5-19(6-8-21)24(30)28-11-1-2-20(17-28)23(29)26-22-9-3-18(4-10-22)16-27-12-14-31-15-13-27/h3-10,20H,1-2,11-17H2,(H,26,29)/t20-/m0/s1 |
| InChIKey | JDRAQBOXNOXXOE-FQEVSTJZSA-N |
| XLogP | 4.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |