C20H18ClN3O2 — CID 153485736
N-(4-chlorophenyl)-1-(3-isocyanobenzoyl)piperidine-3-carboxamide (PubChem CID 153485736) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(3-isocyanobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-(3-isocyanobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 153485736 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(4-chlorophenyl)-1-(3-isocyanobenzoyl)piperidine-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(C(=O)N2CCCC(C(=O)Nc3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C20H18ClN3O2/c1-22-18-6-2-4-14(12-18)20(26)24-11-3-5-15(13-24)19(25)23-17-9-7-16(21)8-10-17/h2,4,6-10,12,15H,3,5,11,13H2,(H,23,25) |
| InChIKey | GKYHRUGQDNFADJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|