C18H23ClN2O4 — CID 119170132
2-[[1-(4-chlorobenzoyl)piperidine-3-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 119170132) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-[[1-(4-chlorobenzoyl)piperidine-3-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[1-(4-chlorobenzoyl)piperidine-3-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119170132 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[[1-(4-chlorobenzoyl)piperidine-3-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN(C(=O)c2ccc(Cl)cc2)C1)C(=O)O |
| InChI | InChI=1S/C18H23ClN2O4/c1-11(2)15(18(24)25)20-16(22)13-4-3-9-21(10-13)17(23)12-5-7-14(19)8-6-12/h5-8,11,13,15H,3-4,9-10H2,1-2H3,(H,20,22)(H,24,25) |
| InChIKey | YNPZNORUMROVTA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |