C21H24ClN3O4S — CID 41079088
(3S)-1-(4-chlorobenzoyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 41079088) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 41079088 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-14(15-6-10-19(11-7-15)30(23,28)29)24-20(26)17-3-2-12-25(13-17)21(27)16-4-8-18(22)9-5-16/h4-11,14,17H,2-3,12-13H2,1H3,(H,24,26)(H2,23,28,29)/t14-,17-/m0/s1 |
| InChIKey | YTHKGKVPRYVBRQ-YOEHRIQHSA-N |
| XLogP | 2.72 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |