C21H24FN3O4S — CID 4884408
1-(4-fluorobenzoyl)-N-[1-(4-sulfamoylphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 4884408) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[1-(4-sulfamoylphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[1-(4-sulfamoylphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4884408 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[1-(4-sulfamoylphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H24FN3O4S/c1-14(15-4-8-19(9-5-15)30(23,28)29)24-20(26)16-10-12-25(13-11-16)21(27)17-2-6-18(22)7-3-17/h2-9,14,16H,10-13H2,1H3,(H,24,26)(H2,23,28,29) |
| InChIKey | QCNGKQRBSKMRTD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |