C22H22BrF3N2O3 — CID 46413518
1-(4-bromobenzoyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 46413518) has the molecular formula C22H22BrF3N2O3 and a molecular weight of 499.33 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46413518 |
| Molecular Formula | C22H22BrF3N2O3 |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)c2ccc(Br)cc2)CC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22BrF3N2O3/c1-14(15-4-8-19(9-5-15)31-22(24,25)26)27-20(29)16-10-12-28(13-11-16)21(30)17-2-6-18(23)7-3-17/h2-9,14,16H,10-13H2,1H3,(H,27,29) |
| InChIKey | KCUPROIBEMBYOS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |