C24H22F2N2O2S — CID 41441647
1-(4-fluorobenzoyl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]piperidine-4-carboxamide (PubChem CID 41441647) has the molecular formula C24H22F2N2O2S and a molecular weight of 440.52 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41441647 |
| Molecular Formula | C24H22F2N2O2S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]piperidine-4-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(F)cc1)c1cccs1)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H22F2N2O2S/c25-19-7-3-16(4-8-19)22(21-2-1-15-31-21)27-23(29)17-11-13-28(14-12-17)24(30)18-5-9-20(26)10-6-18/h1-10,15,17,22H,11-14H2,(H,27,29)/t22-/m0/s1 |
| InChIKey | GPUDZNRHAYFYAD-QFIPXVFZSA-N |
| XLogP | 4.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |