C26H28N2O4S — CID 46472551
1-(3,5-dimethoxybenzoyl)-N-[phenyl(thiophen-2-yl)methyl]piperidine-4-carboxamide (PubChem CID 46472551) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-[phenyl(thiophen-2-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-[phenyl(thiophen-2-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46472551 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-[phenyl(thiophen-2-yl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)NC(c3ccccc3)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C26H28N2O4S/c1-31-21-15-20(16-22(17-21)32-2)26(30)28-12-10-19(11-13-28)25(29)27-24(23-9-6-14-33-23)18-7-4-3-5-8-18/h3-9,14-17,19,24H,10-13H2,1-2H3,(H,27,29) |
| InChIKey | BHQIPLDDIMATQK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |