C21H21NO3S — CID 17488923
3,5-dimethoxy-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzamide (PubChem CID 17488923) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 17488923 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3,5-dimethoxy-N-[(4-methylphenyl)-thiophen-2-ylmethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(c2ccc(C)cc2)c2cccs2)c1 |
| InChI | InChI=1S/C21H21NO3S/c1-14-6-8-15(9-7-14)20(19-5-4-10-26-19)22-21(23)16-11-17(24-2)13-18(12-16)25-3/h4-13,20H,1-3H3,(H,22,23) |
| InChIKey | HCZUDPYMOAMUSJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |