C18H13F2NOS — CID 8854012
3,5-difluoro-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide (PubChem CID 8854012) has the molecular formula C18H13F2NOS and a molecular weight of 329.37 g/mol. Its IUPAC name is 3,5-difluoro-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide.
| Compound Name | 3,5-difluoro-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8854012 |
| Molecular Formula | C18H13F2NOS |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3,5-difluoro-N-[(S)-phenyl(thiophen-2-yl)methyl]benzamide |
| SMILES | O=C(N[C@@H](c1ccccc1)c1cccs1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H13F2NOS/c19-14-9-13(10-15(20)11-14)18(22)21-17(16-7-4-8-23-16)12-5-2-1-3-6-12/h1-11,17H,(H,21,22)/t17-/m0/s1 |
| InChIKey | LLSCUUXDGWFZPI-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |