C18H14FNOS — CID 46565128
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]benzamide (PubChem CID 46565128) has the molecular formula C18H14FNOS and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]benzamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 46565128 |
| Molecular Formula | C18H14FNOS |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]benzamide |
| SMILES | O=C(NC(c1ccc(F)cc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C18H14FNOS/c19-15-10-8-13(9-11-15)17(16-7-4-12-22-16)20-18(21)14-5-2-1-3-6-14/h1-12,17H,(H,20,21) |
| InChIKey | FVIXREUKFBPRJB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |