C19H14FN5OS — CID 46565137
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 46565137) has the molecular formula C19H14FN5OS and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46565137 |
| Molecular Formula | C19H14FN5OS |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NC(c1ccc(F)cc1)c1cccs1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C19H14FN5OS/c20-15-8-6-13(7-9-15)18(17-5-2-10-27-17)22-19(26)14-3-1-4-16(11-14)25-12-21-23-24-25/h1-12,18H,(H,22,26) |
| InChIKey | QEEUIVOWAXQATK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |