C22H21FN2O4S2 — CID 46566179
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 46566179) has the molecular formula C22H21FN2O4S2 and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46566179 |
| Molecular Formula | C22H21FN2O4S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NC(c1ccc(F)cc1)c1cccs1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H21FN2O4S2/c23-18-8-6-16(7-9-18)21(20-5-2-14-30-20)24-22(26)17-3-1-4-19(15-17)31(27,28)25-10-12-29-13-11-25/h1-9,14-15,21H,10-13H2,(H,24,26) |
| InChIKey | OLKIVGVWVCBOHA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |