C17H20N2O4S2 — CID 27770200
3-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 27770200) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 3-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 27770200 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1cccs1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c20-17(18-7-6-15-4-2-12-24-15)14-3-1-5-16(13-14)25(21,22)19-8-10-23-11-9-19/h1-5,12-13H,6-11H2,(H,18,20) |
| InChIKey | IHYRDKUIXJUYBL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |